Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-methoxybenzoyl chloride

Inventory

EC number:
202-816-4
EC name:
Anisoyl chloride
CAS number:
100-07-2
CAS number:
100-07-2
Synonyms
Names:
Benzoyl chloride, 4-methoxy-
Identifier:
IUPAC name
anisoyl chloride
Identifier:
common name
Benzoyl chloride, 4-methoxy-
Identifier:
common name
anisoyl chloride
Identifier:
other: Molecular formula
C8H7CLO2
Identifier:
other: SMILES notation
COC1=CC=C(C=C1)C(=O)Cl
Identifier:
other: SMILES notation
COC1=CC=C(C=C1)C(Cl)=O
Identifier:
other: InChl
InChI=1S/C8H7ClO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3
4-methoxybenzoyl chloride

Molecular and structural information

Molecular formula:
C8H7ClO2
Molecular weight:
170.593
SMILES notation:
COc1ccc(cc1)C(=O)Cl
InChl:
InChI=1/C8H7ClO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3
Structural formula:
Chemical structure

Related substances