Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
5-aminonaphthalene-2-sulfonic acid

Inventory

EC number:
204-351-2
EC name:
5-aminonaphthalene-2-sulphonic acid
CAS number:
119-79-9
CAS number:
119-79-9

Synonyms

Molecular and structural information

Molecular formula:
C10H9NO3S
Molecular weight:
ca. 223.248
SMILES notation:
O=S(=O)(O)c2ccc1c(cccc1N)c2
InChl:
InChI=1S/C10H9NO3S/c11-10-3-1-2-7-6-8(15(12,13)14)4-5-9(7)10/h1-6H,11H2,(H,12,13,14)
Structural formula:
Chemical structure

Related substances