Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2,3-dihydro-2-methyl-1H-indol-1-amine

Inventory

EC number:
250-683-6
EC name:
2,3-dihydro-2-methyl-1H-indol-1-amine
CAS number:
31529-46-1
CAS number:
31529-46-1
Synonyms
Names:
2,3-dihydro-2-methyl-1h-indol-1-amine
Identifier:
IUPAC name
2-methylindolin-1-amine
Identifier:
other: SMILES notation
CC1Cc2ccccc2N1N
2-methyl-2,3-dihydroindol-1-amine

Molecular and structural information

Molecular formula:
C9H12N2
Molecular weight:
148.209
SMILES notation:
CC1CC2=CC=CC=C2N1N
InChl:
InChI=1/C9H12N2/c1-7-6-8-4-2-3-5-9(8)11(7)10/h2-5,7H,6,10H2,1H3
Structural formula:
Chemical structure

Related substances