Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,2-bis(4-hydroxyphenyl)propane

Inventory

EC number:
201-245-8
EC name:
4,4'-isopropylidenediphenol
CAS number:
80-05-7
CAS number:
80-05-7

Synonyms

Molecular and structural information

Molecular formula:
C15H16O2
Molecular weight:
228.29
SMILES notation:
CC(C)(c1ccc(O)cc1)c2ccc(O)cc2
InChl:
InChI=1/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3
Structural formula:
Chemical structure

Related substances