Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one

Inventory

EC number:
219-031-8
EC name:
2-(6-hydroxy-3-oxo-(3H)-xanthen-9-yl)benzoic acid
CAS number:
2321-07-5
CAS number:
2321-07-5
Synonyms
Names:
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-
3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one

Molecular and structural information

Molecular formula:
C20H12O5
Molecular weight:
332.306
SMILES notation:
Oc1ccc2c(Oc3cc(O)ccc3C24OC(=O)c5ccccc45)c1
InChl:
InChI=1/C20H12O5/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20/h1-10,21-22H
Structural formula:
Chemical structure

Related substances