Registration Dossier

IUPAC name:
(1R,2S)-1-phenyl-2-pyrrolidin-1-yl-propan-1-ol;hydrochloride

Inventory

CAS number:
210558-66-0

Synonyms

Molecular and structural information

Molecular formula:
C13H19NO.HCl
Molecular weight:
ca. 241.5
SMILES notation:
Cl.C[C@@H]([C@H](O)c1ccccc1)N2CCCC2
Structural formula:
Chemical structure

Related substances