Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-(4-acetylphenoxy)-2-methylpropanoic acid

Inventory

EC number:
257-705-3
EC name:
2-(4-acetylphenoxy)-2-methylpropionic acid
CAS number:
52179-07-4
CAS number:
52179-07-4
Synonyms
Names:
2-(4-acetylphenoxy)-2-methylpropionic_acid
2-(4-acetylphenoxy)-2-methylpropanoic acid

Molecular and structural information

Molecular formula:
C12H14O4
Molecular weight:
222.237
SMILES notation:
CC(=O)c1ccc(OC(C)(C)C(=O)O)cc1
InChl:
InChI=1/C12H14O4/c1-8(13)9-4-6-10(7-5-9)16-12(2,3)11(14)15/h4-7H,1-3H3,(H,14,15)
Structural formula:
Chemical structure

Related substances