Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(dodecyloxy)sulfonic acid

Inventory

EC number:
205-791-8
EC name:
Dodecyl hydrogen sulphate
CAS number:
151-41-7
CAS number:
151-41-7

Synonyms

Molecular and structural information

Molecular formula:
C12H26O4S
Molecular weight:
266.399
SMILES notation:
C(CCCCCCCCCC)COS(O)(=O)=O
InChl:
1S/C12H26O4S/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15/h2-12H2,1H3,(H,13,14,15)
Structural formula:
Chemical structure

Related substances