Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1-chloro-2-methylprop-1-ene

Inventory

EC number:
208-158-4
EC name:
1-chloro-2-methylpropene
CAS number:
513-37-1
CAS number:
513-37-1
Synonyms
Names:
1-chloro-2-methylpropene
Identifier:
PubChem
2,2-Dimethylvinyl chloride
Identifier:
PubChem
Isocrotyl chloride
Identifier:
other: InChl
InChI=1/C4H7Cl/c1-4(2)3-5/h3H,1-2H3

Molecular and structural information

Molecular formula:
C4H7Cl
Molecular weight:
ca. 90.55
SMILES notation:
CC(=CCl)C
InChl:
InChI=1S/C4H7Cl/c1-4(2)3-5/h3H,1-2H3
Structural formula:
Chemical structure

Related substances