Registration Dossier

Reference substances

Reference substances

IUPAC name:
8-aminonaphthalene-2-sulfonic acid

Inventory

EC number:
204-311-4
EC name:
8-aminonaphthalene-2-sulphonic acid
CAS number:
119-28-8
CAS number:
119-28-8
Synonyms
Names:
2-Naphthalenesulfonic acid, 8-amino-
Identifier:
other: InChl
InChI=1S/C10H9NO3S/c11-10-3-1-2-7-4-5-8(6-9(7)10)15(12,13)14/h1-6H,11H2,(H,12,13,14)
Identifier:
other: SMILES notation
O=S(=O)(O)c1ccc2cccc(N)c2c1
8-aminonaphthalene-2-sulfonic acid

Molecular and structural information

Molecular formula:
C10H9NO3S
Molecular weight:
223.248
SMILES notation:
Nc1cccc2ccc(cc12)S(=O)(=O)O
InChl:
InChI=1/C10H9NO3S/c11-10-3-1-2-7-4-5-8(6-9(7)10)15(12,13)14/h1-6H,11H2,(H,12,13,14)
Structural formula:
Chemical structure

Related substances