Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
monosodium bis[2-((E)-((Z)-3-oxido-1-oxo-1-(phenylamino)but-2-en-2-yl)diazenyl)-4-sulfamoylphenolate (2-)] cobaltate (1-)

Inventory

EC number:
276-701-2
EC name:
Sodium bis[2-[[5-(aminosulphonyl)-2-hydroxyphenyl]azo]-3-oxo-N-phenylbutyramidato(2-)]cobaltate(1-)
CAS number:
72496-88-9
CAS number:
72496-88-9

Synonyms

Molecular and structural information

Molecular formula:
C32H28CoN8NaO10S2
Molecular weight:
ca. 830.6
SMILES notation:
[Na+].[O-]/C(Nc1ccccc1)=C(\N=N\c5cc(ccc5O[Co]2Oc4ccc(cc4N=NC(=C(C)O2)C(=O)Nc3ccccc3)S(N)(=O)=O)S(N)(=O)=O)C(C)=O
InChl:
InChI=1/2C16H16N4O5S.Co.Na/c2*1-10(21)15(16(23)18-11-5-3-2-4-6-11)20-19-13-9-12(26(17,24)25)7-8-14(13)22;;/h2-9,21-22H,1H3,(H,18,23)(H2,17,24,25);2-9,18,22-23H,1H3,(H2,17,24,25);;/q;;+3;+1/p-4/b15-10-,20-19-;16-15-,20-19+;;
Structural formula:
Chemical structure

Related substances