Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
heptanoic acid

Inventory

EC number:
203-838-7
EC name:
Heptanoic acid
CAS number:
111-14-8
CAS number:
111-14-8
Synonyms
Names:
Heptanoic acid

Molecular and structural information

Molecular formula:
C7H14O2
Molecular weight:
130.185
SMILES notation:
CCCCCCC(=O)O
InChl:
InChI=1/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9)
Structural formula:
Chemical structure

Related substances

Categories Display