Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
pentadecanoic acid

Inventory

EC number:
213-693-1
EC name:
Pentadecanoic acid
CAS number:
1002-84-2
CAS number:
1002-84-2
Synonyms
Names:
Pentadecanoic acid

Molecular and structural information

Molecular formula:
C15H30O2
Molecular weight:
242.398
SMILES notation:
CCCCCCCCCCCCCCC(=O)O
InChl:
InChI=1/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17)
Structural formula:
Chemical structure

Related substances

Categories Display