Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
tributyl(methyl)azanium chloride

Inventory

EC number:
260-135-8
EC name:
Tributylmethylammonium chloride
CAS number:
56375-79-2
CAS number:
56375-79-2
Synonyms
Names:
1-Butanaminium, N,N-dibutyl-N-methyl-, chloride
Identifier:
IUPAC name
1-Butanaminium, N,N-dibutyl-N-methyl-, chloride (1:1)
Identifier:
IUPAC name
Methy tributyl ammonium chloride
Identifier:
IUPAC name
N,N-dibutyl-N-methylbutan-1-aminium chloride
Identifier:
IUPAC name
Tributyl-methyl-ammonium chloride
Identifier:
IUPAC name
Tributylmethylammonium chloride
Identifier:
IUPAC name
tributyl(methyl)azanium chloride
Identifier:
other: InChl
1S/C13H30N.ClH/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;/h5-13H2,1-4H3;1H/q+1;/p-1
Identifier:
other: InChl
1S/C13H30N.ClH/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;/h5-13H2,1-4H3;1H/q+1;/p-1
Identifier:
other: SMILES notation
[N+](CCCC)(CCCC)(CCCC)C.[ClH-]
Identifier:
other: SMILES notation
[N+](CCCC)(CCCC)(CCCC)C.[ClH-]
Tributylmethylammonium chloride

Molecular and structural information

Molecular formula:
C13H30N.Cl
Molecular weight:
235.8
SMILES notation:
[Cl-].CCCC[N+](C)(CCCC)CCCC
InChl:
InChI=1/C13H30N.ClH/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;/h5-13H2,1-4H3;1H/q+1;/p-1
Structural formula:
Chemical structure

Related substances