Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,3-dihydro-1-benzofuran-2-one

Inventory

EC number:
209-052-0
EC name:
(3H)-benzofuran-2-one
CAS number:
553-86-6
CAS number:
553-86-6
Synonyms
Names:
(3h)-benzofuran-2-one
2-Coumaranone
1-benzofuran-2(3H)-one

Molecular and structural information

Molecular formula:
C8H6O2
Molecular weight:
134.132
SMILES notation:
O=C1Cc2ccccc2O1
InChl:
InChI=1/C8H6O2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-4H,5H2
Structural formula:
Chemical structure

Related substances