Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1-benzyl-5-ethyl-2-methylpyridinium chloride

Inventory

EC number:
299-666-5
EC name:
1-benzyl-5-ethyl-2-methylpyridinium chloride
CAS number:
93893-74-4
CAS number:
93893-74-4

Synonyms

Molecular and structural information

Molecular formula:
C15H18N.Cl
Molecular weight:
247.763
SMILES notation:
[Cl-].CCc1ccc(C)[n+](Cc2ccccc2)c1
InChl:
InChI=1/C15H18N.ClH/c1-3-14-10-9-13(2)16(11-14)12-15-7-5-4-6-8-15;/h4-11H,3,12H2,1-2H3;1H/q+1;/p-1
Structural formula:
Chemical structure

Related substances