Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,5-dibenzyl-2-ethyl-pyridin-1-ium chloride

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C21H22CIN
Molecular weight:
ca. 323
SMILES notation:
[Cl-].CCc3ccc(Cc1ccccc1)c[n+]3Cc2ccccc2
InChl:
1S/C21H22N.ClH/c1-2-21-14-13-20(15-18-9-5-3-6-10-18)17-22(21)16-19-11-7-4-8-12-19;/h3-14,17H,2,15-16H2,1H3;1H/q+1;/p-1
Structural formula:
Chemical structure

Related substances