Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
acryloyl chloride

Inventory

EC number:
212-399-0
EC name:
Acryloyl chloride
CAS number:
814-68-6
CAS number:
814-68-6
Synonyms
Names:
2-Propenoyl chloride
Identifier:
IUPAC name
2-Propenoyl chloride
Identifier:
other: InChl
1S/C3H3ClO/c1-2-3(4)5/h2H,1H2
acryloyl chloride

Molecular and structural information

Molecular formula:
C3H3ClO
Molecular weight:
90.508
SMILES notation:
ClC(=O)C=C
InChl:
InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2
Structural formula:
Chemical structure

Related substances