Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
bis[3,7-bis(diethylamino)phenoxazin-5-ium] tetrachlorozincate(2-)

Inventory

EC number:
264-355-5
EC name:
3,7-bis(diethylamino)phenoxazin-5-ium tetrachlorozincate (2:1)
CAS number:
63589-47-9
CAS number:
63589-47-9
Synonyms
Names:
Phenoxazin-5-ium, 3,7-bis(diethylamino)-, (T-4)-tetrachlorozincate(2-) (2:1)

Molecular and structural information

Molecular formula:
C20H26N3O.1/2Cl4Zn
Molecular weight:
856.101
SMILES notation:
CCN(CC)c1ccc2nc3ccc(cc3[o+]c2c1)N(CC)CC.CCN(CC)c4ccc5nc6ccc(cc6[o+]c5c4)N(CC)CC.Cl[Zn-2](Cl)(Cl)Cl
InChl:
InChI=1/2C20H26N3O.4ClH.Zn/c2*1-5-22(6-2)15-9-11-17-19(13-15)24-20-14-16(23(7-3)8-4)10-12-18(20)21-17;;;;;/h2*9-14H,5-8H2,1-4H3;4*1H;/q2*+1;;;;;+2/p-4/r2C20H26N3O.Cl4Zn/c2*1-5-22(6-2)15-9-11-17-19(13-15)24-20-14-16(23(7-3)8-4)10-12-18(20)21-17;1-5(2,3)4/h2*9-14H,5-8H2,1-4H3;/q2*+1;-2
Structural formula:
Chemical structure

Related substances