Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
3,7-bis(diethylamino)phenoxazin-5-ium acetate

Inventory

EC number:
279-349-8
EC name:
3,7-bis(diethylamino)phenoxazin-5-ium acetate
CAS number:
79916-07-7
CAS number:
79916-07-7
Synonyms
Names:
Phenoxazin-5-ium, 3,7-bis(diethylamino)-, acetate

Molecular and structural information

Molecular formula:
C20H26N3O.C2H3O2
Molecular weight:
383.484
SMILES notation:
CCN(CC)c1ccc2nc3ccc(cc3[o+]c2c1)N(CC)CC.CC(=O)[O-]
InChl:
InChI=1/C20H26N3O.C2H4O2/c1-5-22(6-2)15-9-11-17-19(13-15)24-20-14-16(23(7-3)8-4)10-12-18(20)21-17;1-2(3)4/h9-14H,5-8H2,1-4H3;1H3,(H,3,4)/q+1;/p-1
Structural formula:
Chemical structure

Related substances