Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
calcium chloride [2-(trimethylazaniumyl)ethyl] phosphate

Inventory

EC number:
225-403-0
EC name:
Trimethyl[2-(phosphonooxy)ethyl]ammonium chloride, calcium salt (1:1)
CAS number:
4826-71-5
CAS number:
4826-71-5
Synonyms
Names:
Identifier:
common name
calcium phosphorylcholine chloride

Molecular and structural information

Molecular formula:
C5H13NO4P.Ca.Cl
Molecular weight:
257.67
SMILES notation:
[Ca+2].[Cl-].[O-]P([O-])(=O)OCC[N+](C)(C)C
InChl:
InChI=1/C5H14NO4P.Ca.ClH/c1-6(2,3)4-5-10-11(7,8)9;;/h4-5H2,1-3H3,(H-,7,8,9);;1H/q;+2;/p-2
Structural formula:
Chemical structure

Related substances