Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-yne

Inventory

EC number:
213-944-5
EC name:
Di-tert-butyl 1,1,4,4-tetramethylbut-2-yn-1,4-ylene diperoxide
CAS number:
1068-27-5
CAS number:
1068-27-5
Synonyms
Names:
Peroxide, (1,1,4,4-tetramethyl-2-butyne- 1,4-diyl)bis[(1,1-dimethylethyl)
Peroxide, (1,1,4,4-tetramethyl-2-butyne-1,4-diyl)bis (1,1-dimethylethyl)
Peroxide, (1,1,4,4-tetramethyl-2-butyne-1,4-diyl)bis[(1,1-dimethylethyl)
Identifier:
other: trade name
Enox®YNE
2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-yne

Molecular and structural information

Molecular formula:
C16H30O4
Molecular weight:
286.407
SMILES notation:
CC(C)(C)OOC(C)(C)C#CC(C)(C)OOC(C)(C)C
InChl:
InChI=1/C16H30O4/c1-13(2,3)17-19-15(7,8)11-12-16(9,10)20-18-14(4,5)6/h1-10H3
Structural formula:
Chemical structure

Related substances