Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,4-bis[(2-methylphenyl)amino]-9,10-dihydroanthracene-9,10-dione

Inventory

EC number:
229-792-8
EC name:
1,4-bis[(2-methylphenyl)amino]anthraquinone
CAS number:
6737-68-4
CAS number:
6737-68-4
Synonyms
Names:
1,4-bis[(2-methylphenyl)amino]anthraquinone

Molecular and structural information

Molecular formula:
C28H22N2O2
Molecular weight:
418.494
SMILES notation:
c1cc2C(=O)c3c(C(=O)c2cc1)c(Nc1ccccc1C)ccc3Nc1c(cccc1)C
InChl:
1S/C28H22N2O2/c1-17-9-3-7-13-21(17)29-23-15-16-24(30-22-14-8-4-10-18(22)2)26-25(23)27(31)19-11-5-6-12-20(19)28(26)32/h3-16,29-30H,1-2H3
Structural formula:
Chemical structure

Related substances