Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
3-aminopyrazine-2-carboxylic acid

Inventory

EC number:
226-558-7
EC name:
3-aminopyrazine-2-carboxylic acid
CAS number:
5424-01-1
CAS number:
5424-01-1
Synonyms
Names:
Amiloride Compound 5
3-aminopyrazine-2-carboxylic acid

Molecular and structural information

Molecular formula:
C5H5N3O2
Molecular weight:
139.11
SMILES notation:
Nc1nccnc1C(=O)O
InChl:
InChI=1/C5H5N3O2/c6-4-3(5(9)10)7-1-2-8-4/h1-2H,(H2,6,8)(H,9,10)
Structural formula:
Chemical structure

Related substances