Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
benzene-1,3,5-tricarboxylic acid

Inventory

EC number:
209-077-7
EC name:
Benzene-1,3,5-tricarboxylic acid
CAS number:
554-95-0
CAS number:
554-95-0
Synonyms
Names:
1,3,5-Benzenetricarboxylic acid
benzene-1,3,5-tricarboxylic acid

Molecular and structural information

Molecular formula:
C9H6O6
Molecular weight:
210.14
SMILES notation:
OC(=O)c1cc(cc(c1)C(=O)O)C(=O)O
InChl:
InChI=1/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15)
Structural formula:
Chemical structure

Related substances