Registration Dossier

Diss Factsheets

IUPAC name:
1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanone;nitric acid

Inventory

EC number:
246-039-9
EC name:
1-[2-(2,4-dichlorophenyl)-2-oxoethyl]-1H-imidazole mononitrate
CAS number:
24155-29-1
CAS number:
24155-29-1

Synonyms

Molecular and structural information

Molecular formula:
C11H9Cl2N3O4
Molecular weight:
318.11
SMILES notation:
C1=CC(=C(C=C1Cl)Cl)C(=O)CN2C=CN=C2.[N+](=O)(O)[O-]
Structural formula:
Chemical structure

Related substances

Categories Display