Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
other name: dodecane, 2-sulphonic acid, sodium salt

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C12H25NaO3S
Molecular weight:
272.381
SMILES notation:
[Na]OS(=O)(=O)C(C)CCCCCCCCCC
Structural formula:
Chemical structure

Related substances