Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
chromium(3+) ion hydrogen bis(1-(3-chlorophenyl)-4-[(E)-2-(5-methanesulfonyl-2-oxidophenyl)diazen-1-yl]-3-methyl-1H-pyrazol-5-olate)

Inventory

EC number:
275-660-8
EC name:
Hydrogen bis[2-(3-chlorophenyl)-2,4-dihydro-4-[[2-hydroxy-5-mesylphenyl]azo]-5-methyl-3H-pyrazol-3-onato(2-)]chromate(1-)
CAS number:
71598-35-1
CAS number:
71598-35-1
Synonyms
Names:
Identifier:
CAS number
68647-35-8

Molecular and structural information

Molecular formula:
C34H26Cl2CrN8O8S2.H
Molecular weight:
862.669
SMILES notation:
c1(cccc(c1)Cl)N1N=C([C@@-](C1=O)\N=N\c1c(ccc(S(C)(=O)=O)c1)[O-])C.[Cr+3].O=S(c1cc(c(cc1)[O-])\N=N\[C@@-]1C(=NN(C1=O)c1cc(ccc1)Cl)C)(C)=O
InChl:
1S/2C17H14ClN4O4S.Cr/c2*1-10-16(17(24)22(21-10)12-5-3-4-11(18)8-12)20-19-14-9-13(27(2,25)26)6-7-15(14)23;/h2*3-9,23H,1-2H3;/q2*-1;+3/p-1/b2*20-19+;
Structural formula:
Chemical structure

Related substances