Registration Dossier

Reference substances

Reference substances

IUPAC name:
3-cyclopentylpropionyl chloride

Inventory

EC number:
203-257-9
EC name:
3-cyclopentylpropionyl chloride
CAS number:
104-97-2
CAS number:
104-97-2
Synonyms
Names:
3-cyclopentylpropionyl_chloride
Identifier:
other: SMILES notation
ClC(=O)CCC1CCCC1
3-cyclopentylpropanoyl chloride

Molecular and structural information

Molecular formula:
C8H13ClO
Molecular weight:
ca. 160.6
SMILES notation:
O=C(Cl)CCC1CCCC1
InChl:
InChI=1/C8H13ClO/c9-8(10)6-5-7-3-1-2-4-7/h7H,1-6H2
Structural formula:
Chemical structure

Related substances