Registration Dossier

Reference substances

Reference substances

IUPAC name:
4-methoxybenzoic acid

Inventory

EC number:
202-818-5
EC name:
p-anisic acid
CAS number:
100-09-4
CAS number:
100-09-4
Synonyms
Names:
Identifier:
IUPAC name
4-methoxybenzoic acid
Identifier:
IUPAC name
p-methoxybenzoic acid
p-Methoxybenzoic acid

Molecular and structural information

Molecular formula:
C8H8O3
Molecular weight:
152.15
SMILES notation:
COC1=CC=C(C=C1)C(O)=O
InChl:
InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) AuxInfo=1/1/N:11,2,6,3,5,1,4,7,8,9,10/E
Structural formula:
Chemical structure

Related substances