Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
reaction mass of diethyl (E)-2-methylbut-2-enedioate and diethyl (Z)-2-methylbut-2-enedioate

Inventory

CAS number:
73326-59-7

Synonyms

Molecular and structural information

Molecular formula:
C9H14O4
Molecular weight:
186.205
SMILES notation:
CCOC(=O)\C=C(/C)\C(=O)OCC
CCOC(=O)\C=C(\C)/C(=O)OCC
InChl:
InChI=1/C9H14O4/c1-4-12-8(10)6-7(3)9(11)13-5-2/h6H,4-5H2,1-3H3/b7-6+
InChI=1/C9H14O4/c1-4-12-8(10)6-7(3)9(11)13-5-2/h6H,4-5H2,1-3H3/b7-6-
Structural formula:
Chemical structure

Related substances