Registration Dossier

IUPAC name:
2-Amino-1-dodecanol

Inventory

CAS number:
97028-87-0

Synonyms

Molecular and structural information

Molecular formula:
C12H27NO
Molecular weight:
201.35
SMILES notation:
CCCCCCCCCCC(N)CO
InChl:
InChI=1S/C12H27NO/c1-2-3-4-5-6-7-8-9-10-12(13)11-14/h12,14H,2-11,13H2,1H3
Structural formula:
Chemical structure

Related substances