Registration Dossier

IUPAC name:
2-amino-3-phenylpropan-1-ol

Inventory

EC number:
226-086-1
EC name:
(R)-2-amino-3-phenylpropanol
CAS number:
5267-64-1
CAS number:
5267-64-1

Synonyms

Molecular and structural information

Molecular formula:
C9H13NO
Molecular weight:
151.206
SMILES notation:
N[C@@H](CO)Cc1ccccc1
InChl:
InChI=1/C9H13NO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-5,9,11H,6-7,10H2
Structural formula:
Chemical structure

Related substances