Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1-Propanaminium, 3-amino-N-(2-hydroxyethyl)-N,N-dimethyl-,cis,cis-9,12-Octadecadienoic ester, chloride

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C25 H48 N2 O2 (Cl)
Molecular weight:
409.382
SMILES notation:
C(=O)(CCCCCC=CC=CCCCCCCCC)NCCCN(C)(C)CCOCl
Structural formula:
Chemical structure

Related substances