Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
5-methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one

Inventory

EC number:
201-891-0
EC name:
3-methyl-1-phenyl-5-pyrazolone
CAS number:
89-25-8
CAS number:
89-25-8
Synonyms
Names:
2,4-dihydro-5-methyl-2-phenyl-3h-pyrazo-3-one
3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl-

Molecular and structural information

Molecular formula:
C10H10N2O
Molecular weight:
174.199
SMILES notation:
CC1=NN(C(=O)C1)c2ccccc2
InChl:
InChI=1/C10H10N2O/c1-8-7-10(13)12(11-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3
Structural formula:
Chemical structure

Related substances