Registration Dossier

Diss Factsheets

IUPAC name:
4-methoxy-2,3,6-trimethylbenzaldehyde

Inventory

EC number:
259-117-2
EC name:
2,3,6-trimethyl-p-anisaldehyde
CAS number:
54344-92-2
CAS number:
54344-92-2

Synonyms

Molecular and structural information

Molecular formula:
C11H14O2
Molecular weight:
178.228
SMILES notation:
COc1cc(C)c(C=O)c(C)c1C
InChl:
InChI=1/C11H14O2/c1-7-5-11(13-4)9(3)8(2)10(7)6-12/h5-6H,1-4H3
Structural formula:
Chemical structure

Related substances