Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
diphenylperoxyanhydride

Inventory

EC number:
202-327-6
EC name:
Dibenzoyl peroxide
CAS number:
94-36-0
CAS number:
94-36-0
Synonyms
Names:
benzoyl benzenecarboperoxoate

Molecular and structural information

Molecular formula:
C14H10O4
Molecular weight:
ca. 242.23
SMILES notation:
C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2
Structural formula:
Chemical structure

Related substances