Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2,6-dichlorobenzyl chloride

Inventory

EC number:
217-940-4
EC name:
2,6-dichlorobenzyl chloride
CAS number:
2014-83-7
CAS number:
2014-83-7
Synonyms
Names:
2,6-dichlorobenzyl_chloride
1,3-dichloro-2-(chloromethyl)benzene

Molecular and structural information

Molecular formula:
C7H5Cl3
Molecular weight:
195.474
SMILES notation:
ClCc1c(Cl)cccc1Cl
InChl:
InChI=1/C7H5Cl3/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2
Structural formula:
Chemical structure

Related substances