Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(2R)-2-(undec-10-enoylamino)-3-phenylpropanoic acid

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C20H29NO3
Molecular weight:
331.4
SMILES notation:
O=C(O)[C@H](NC(=O)CCCCCCCCC=C)Cc1ccccc1
Structural formula:
Chemical structure

Related substances