Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-cyanobenzoic acid

Inventory

EC number:
210-606-9
EC name:
4-cyanobenzoic acid
CAS number:
619-65-8
CAS number:
619-65-8
Synonyms
Names:
4-cyanobenzoic_acid
Benzoic acid, 4-cyano-
4-cyanobenzoic acid

Molecular and structural information

Molecular formula:
C8H5NO2
Molecular weight:
147.131
SMILES notation:
OC(=O)c1ccc(cc1)C#N
InChl:
InChI=1/C8H5NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,(H,10,11)
Structural formula:
Chemical structure

Related substances