Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
bis(1,3-dimethylbutyl) maleate

Inventory

EC number:
203-304-3
EC name:
Bis(1,3-dimethylbutyl) maleate
CAS number:
105-52-2
CAS number:
105-52-2
Synonyms
Names:
2-Butenedioic acid (2Z)-, bis(1,3-dimethylbutyl) ester
bis(1,3-dimethylbutyl) but-2-enedioate

Molecular and structural information

Molecular formula:
C16H28O4
Molecular weight:
284.391
SMILES notation:
CC(C)CC(C)OC(=O)\C=C/C(=O)OC(C)CC(C)C
InChl:
InChI=1/C16H28O4/c1-11(2)9-13(5)19-15(17)7-8-16(18)20-14(6)10-12(3)4/h7-8,11-14H,9-10H2,1-6H3
Structural formula:
Chemical structure

Related substances