Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
decanoic acid

Inventory

EC number:
206-376-4
EC name:
Decanoic acid
CAS number:
334-48-5
CAS number:
334-48-5
Synonyms
Names:
Decanoic acid

Molecular and structural information

Molecular formula:
C10H20O2
Molecular weight:
172.265
SMILES notation:
CCCCCCCCCC(=O)O
InChl:
InChI=1/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)
Structural formula:
Chemical structure

Related substances