Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1-{[3-({[2-hydroxy-3-(2-methylphenoxy)propyl]amino}methyl)-3,5,5-trimethylcyclohexyl]amino}-3-(2-methylphenoxy)propan-2-ol

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C29H42O4
Molecular weight:
454.64
SMILES notation:
Cc3cccc(OCC(O)CNCC2(C)CC(NCC(O)COc1ccccc1C)CC(C)(C)C2)c3
Structural formula:
Chemical structure

Related substances