Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Iron(3+) ion sodium 5-[bis(carboxylatomethyl)amino]-3-{[bis(carboxylatomethyl)amino]methoxy}pentanoate


EC number:
EC name:
Sodium hydrogen [N,N-bis[2-[bis(carboxymethyl)amino]ethyl]glycinato(5-)]ferrate(2-)
CAS number:
CAS number:
diethylenetriaminepentaacetic acid ferric-sodium complex
iron(3+) ion sodium 2-\\{[2-(\\{2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)ethyl](carboxymethyl)amino}acetate]
sodium hydrogen ferric diethylenetriaminepentaacetate
sodium hydrogen ferric dtpa
sodium; 2-[2-[bis(2-oxido-2-oxoethyl)amino]ethyl-[2-[carboxymethyl-(2-oxido-2-oxoethyl)amino]ethyl]amino]acetate; iron(+3) cation

Molecular and structural information

Molecular formula:
Molecular weight:
SMILES notation:

synonym: C([N@@](CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-])C[N@@](CC(O)=O)CC(=O)[O-].[Fe+3].[Na+]
Structural formula:
Chemical structure

Related substances

Categories Display