Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
diphenylamine

Inventory

EC number:
204-539-4
EC name:
Diphenylamine
CAS number:
122-39-4
CAS number:
122-39-4
Synonyms
Names:
Diphenylamine

Molecular and structural information

Molecular formula:
C12H11N
Molecular weight:
>= 169.23
SMILES notation:
N(C1=CC=CC=C1)C1=CC=CC=C1
InChl:
InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H
Structural formula:
Chemical structure

Related substances