Registration Dossier

Diss Factsheets

IUPAC name:
Methyl 5-methyl-1,2-oxazole-4-carboxylate

Inventory

CAS number:
100047-54-9

Synonyms

Molecular and structural information

Molecular formula:
C6H7NO3
Molecular weight:
ca. 141.1
SMILES notation:
Cc1oncc1C(=O)OC
InChl:
InChI=1/C6H7NO3/c1-4-5(3-7-10-4)6(8)9-2/h3H,1-2H3
Structural formula:
Chemical structure

Related substances

Categories Display