Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
5-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-aminium chloride

Inventory

CAS number:
3904-24-3
Synonyms
Names:
5-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-aminium chloride

Molecular and structural information

Molecular formula:
C14H21NO.HCl
Molecular weight:
255.14
SMILES notation:
CCCNC2CCc1c(cccc1OC)C2
InChl:
InChI=1S/C14H21NO/c1-3-9-15-12-7-8-13-11(10-12)5-4-6-14(13)16-2/h4-6,12,15H,3,7-10H2,1-2H3
Structural formula:
Chemical structure

Related substances