Registration Dossier

Reference substances

Reference substances

IUPAC name:
acetyl chloride

Inventory

EC number:
201-178-4
EC name:
Chloroacetic acid
CAS number:
79-11-8
CAS number:
79-11-8
Synonyms
Names:
Acetic acid, chloro-
Identifier:
IUPAC name
2-chloroacetic acid
Identifier:
IUPAC name
acetyl chloride
Chloroacetic acid

Molecular and structural information

Molecular formula:
C2H3ClO2
Molecular weight:
94.497
SMILES notation:
CC(Cl)=O
InChl:
InChI=1/C2H3ClO/c1-2(3)4/h1H3
Structural formula:
Chemical structure

Related substances