Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
5-iodo-2-methylbenzoic acid

Inventory

CAS number:
54811-38-0
Synonyms
Names:
5-Iodo-2-Methylbenzoic acid

Molecular and structural information

Molecular formula:
C8H7IO2
Molecular weight:
ca. 262.05
SMILES notation:
CC1=C(C=C(C=C1)I)C(=O)O
InChl:
InChI=1S/C8H7IO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11)
Structural formula:
Chemical structure

Related substances