Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
diethyl ethoxymethylenemalonate

Inventory

EC number:
201-725-7
EC name:
Diethyl ethoxymethylenemalonate
CAS number:
87-13-8
CAS number:
87-13-8
Synonyms
Names:
Identifier:
common name
3-Methyl-2(1H)-pyridinone
DIETHYL (ETHOXYMETHYLIDENE)PROPANEDIOATE

Molecular and structural information

Molecular formula:
C10H16O5
Molecular weight:
216.24
SMILES notation:
Cc1ccc[nH]c1=O
InChl:
InChI=1S/C6H7NO/c1-5-3-2-4-7-6(5)8/h2-4H,1H3,(H,7,8)
Structural formula:
Chemical structure

Related substances

Categories Display